 Click image to view full size image |
|
| Product: |
Views:135Methyl 4-methylbenzoate |
| Unit price: |
Negotiable |
| MOQ: |
|
| Quantity: |
|
| Delivery date: |
Since the payment date Days delivery |
| Valid until: |
Long-term effective |
| Last updated: |
2017-08-14 12:30 |
| |
 |
|
Methyl 4-methylbenzoate
| Category: |
Intermediates |
|
| CAS NO: |
99-75-2 |
| EC NO: |
202-784-1 |
| Molecular Formula: |
C9H10O2
|
| Molecular Weight: |
150.1745 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O2/c1-7-3-5-8(6-4-7)9(10)11-2/h3-6H,1-2H3 |
| Synonyms: |
p-Toluic acid methyl ester;methyl 4-methylbenzoate;METHYL-P-METHYL BENZOATE; |
| Molecular Structure: |
 |
|
